Thread: Inverse Trig compund identities?

Are there inverse trig identities, analagous to:

sin(A+B)=sinAcosB+cosAsinB ?

I know there are various identities dealing with the sum of two inverse trig functions, but I was wondering if there was a nice way to split up a compound variable, for want of a better word.

If there are, please don't post a proof because I'd rather try and prove them myself.

Thanks

EDIT: Sorry for the typo in the title